C12H15NO — CID 83530616
1-(1-isocyanatoethyl)-2,4,5-trimethylbenzene (PubChem CID 83530616) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(1-isocyanatoethyl)-2,4,5-trimethylbenzene.
| Compound Name | 1-(1-isocyanatoethyl)-2,4,5-trimethylbenzene |
|---|---|
| PubChem CID | 83530616 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1-(1-isocyanatoethyl)-2,4,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(C(C)N=C=O)cc1C |
| InChI | InChI=1S/C12H15NO/c1-8-5-10(3)12(6-9(8)2)11(4)13-7-14/h5-6,11H,1-4H3 |
| InChIKey | CMQUZMMTBUOTIZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|