C12H20N2 — CID 116954358
N,N'-dimethyl-1-(2,4,5-trimethylphenyl)methanediamine (PubChem CID 116954358) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N,N'-dimethyl-1-(2,4,5-trimethylphenyl)methanediamine.
| Compound Name | N,N'-dimethyl-1-(2,4,5-trimethylphenyl)methanediamine |
|---|---|
| PubChem CID | 116954358 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N,N'-dimethyl-1-(2,4,5-trimethylphenyl)methanediamine |
| SMILES | CNC(NC)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C12H20N2/c1-8-6-10(3)11(7-9(8)2)12(13-4)14-5/h6-7,12-14H,1-5H3 |
| InChIKey | YEUDVGDRWYKOBR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|