C9H11NO2S — CID 116939551
amino-(6-methyl-1,3-benzodioxol-5-yl)methanethiol (PubChem CID 116939551) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is amino-(6-methyl-1,3-benzodioxol-5-yl)methanethiol.
| Compound Name | amino-(6-methyl-1,3-benzodioxol-5-yl)methanethiol |
|---|---|
| PubChem CID | 116939551 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | amino-(6-methyl-1,3-benzodioxol-5-yl)methanethiol |
| SMILES | Cc1cc2c(cc1C(N)S)OCO2 |
| InChI | InChI=1S/C9H11NO2S/c1-5-2-7-8(12-4-11-7)3-6(5)9(10)13/h2-3,9,13H,4,10H2,1H3 |
| InChIKey | XFZDHVUIKLXWEG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|