C11H15NO3 — CID 116947302
methoxy-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)methanamine (PubChem CID 116947302) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is methoxy-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)methanamine.
| Compound Name | methoxy-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)methanamine |
|---|---|
| PubChem CID | 116947302 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | methoxy-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)methanamine |
| SMILES | COC(N)c1cc2c(cc1C)OCCO2 |
| InChI | InChI=1S/C11H15NO3/c1-7-5-9-10(15-4-3-14-9)6-8(7)11(12)13-2/h5-6,11H,3-4,12H2,1-2H3 |
| InChIKey | VMDPRNHMVVZNBL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|