C12H10ClNO2S — CID 171234793
(S)-(6-chloro-1,3-benzodioxol-5-yl)-thiophen-3-ylmethanamine (PubChem CID 171234793) has the molecular formula C12H10ClNO2S and a molecular weight of 267.74 g/mol. Its IUPAC name is (S)-(6-chloro-1,3-benzodioxol-5-yl)-thiophen-3-ylmethanamine.
| Compound Name | (S)-(6-chloro-1,3-benzodioxol-5-yl)-thiophen-3-ylmethanamine |
|---|---|
| PubChem CID | 171234793 |
| Molecular Formula | C12H10ClNO2S |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | (S)-(6-chloro-1,3-benzodioxol-5-yl)-thiophen-3-ylmethanamine |
| SMILES | N[C@@H](c1ccsc1)c1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C12H10ClNO2S/c13-9-4-11-10(15-6-16-11)3-8(9)12(14)7-1-2-17-5-7/h1-5,12H,6,14H2/t12-/m0/s1 |
| InChIKey | XLZPLWIYTOJZHG-LBPRGKRZSA-N |
| XLogP | 3.18 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |