C11H9Cl2NS — CID 171232158
(S)-(2,4-dichlorophenyl)-thiophen-3-ylmethanamine (PubChem CID 171232158) has the molecular formula C11H9Cl2NS and a molecular weight of 258.17 g/mol. Its IUPAC name is (S)-(2,4-dichlorophenyl)-thiophen-3-ylmethanamine.
| Compound Name | (S)-(2,4-dichlorophenyl)-thiophen-3-ylmethanamine |
|---|---|
| PubChem CID | 171232158 |
| Molecular Formula | C11H9Cl2NS |
| Molecular Weight | 258.17 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | (S)-(2,4-dichlorophenyl)-thiophen-3-ylmethanamine |
| SMILES | N[C@@H](c1ccsc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl2NS/c12-8-1-2-9(10(13)5-8)11(14)7-3-4-15-6-7/h1-6,11H,14H2/t11-/m0/s1 |
| InChIKey | PSMQLRBANYACIG-NSHDSACASA-N |
| XLogP | 4.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.17 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |