C12H11ClN2O4S — CID 171228084
(R)-(6-nitro-1,3-benzodioxol-5-yl)-thiophen-3-ylmethanamine;hydrochloride (PubChem CID 171228084) has the molecular formula C12H11ClN2O4S and a molecular weight of 314.75 g/mol. Its IUPAC name is (R)-(6-nitro-1,3-benzodioxol-5-yl)-thiophen-3-ylmethanamine;hydrochloride.
| Compound Name | (R)-(6-nitro-1,3-benzodioxol-5-yl)-thiophen-3-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171228084 |
| Molecular Formula | C12H11ClN2O4S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | (R)-(6-nitro-1,3-benzodioxol-5-yl)-thiophen-3-ylmethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccsc1)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C12H10N2O4S.ClH/c13-12(7-1-2-19-5-7)8-3-10-11(18-6-17-10)4-9(8)14(15)16;/h1-5,12H,6,13H2;1H/t12-;/m0./s1 |
| InChIKey | WRMLVNQEGIUJOZ-YDALLXLXSA-N |
| XLogP | 2.85 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|