C12H14ClNO3 — CID 43685909
6-chloro-N-(oxolan-3-ylmethyl)-1,3-benzodioxol-5-amine (PubChem CID 43685909) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is 6-chloro-N-(oxolan-3-ylmethyl)-1,3-benzodioxol-5-amine.
| Compound Name | 6-chloro-N-(oxolan-3-ylmethyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 43685909 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 6-chloro-N-(oxolan-3-ylmethyl)-1,3-benzodioxol-5-amine |
| SMILES | Clc1cc2c(cc1NCC1CCOC1)OCO2 |
| InChI | InChI=1S/C12H14ClNO3/c13-9-3-11-12(17-7-16-11)4-10(9)14-5-8-1-2-15-6-8/h3-4,8,14H,1-2,5-7H2 |
| InChIKey | ZFZAZVPIMPLKHV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|