C13H10ClNO5 — CID 104608322
5-[[(6-chloro-1,3-benzodioxol-5-yl)amino]methyl]furan-3-carboxylic acid (PubChem CID 104608322) has the molecular formula C13H10ClNO5 and a molecular weight of 295.68 g/mol. Its IUPAC name is 5-[[(6-chloro-1,3-benzodioxol-5-yl)amino]methyl]furan-3-carboxylic acid.
| Compound Name | 5-[[(6-chloro-1,3-benzodioxol-5-yl)amino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104608322 |
| Molecular Formula | C13H10ClNO5 |
| Molecular Weight | 295.68 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 5-[[(6-chloro-1,3-benzodioxol-5-yl)amino]methyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1coc(CNc2cc3c(cc2Cl)OCO3)c1 |
| InChI | InChI=1S/C13H10ClNO5/c14-9-2-11-12(20-6-19-11)3-10(9)15-4-8-1-7(5-18-8)13(16)17/h1-3,5,15H,4,6H2,(H,16,17) |
| InChIKey | FUEISKDFRYQSCD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.68 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|