C15H11ClN2O3 — CID 104608662
5-[[(5-chloroquinolin-8-yl)amino]methyl]furan-3-carboxylic acid (PubChem CID 104608662) has the molecular formula C15H11ClN2O3 and a molecular weight of 302.72 g/mol. Its IUPAC name is 5-[[(5-chloroquinolin-8-yl)amino]methyl]furan-3-carboxylic acid.
| Compound Name | 5-[[(5-chloroquinolin-8-yl)amino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104608662 |
| Molecular Formula | C15H11ClN2O3 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 5-[[(5-chloroquinolin-8-yl)amino]methyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1coc(CNc2ccc(Cl)c3cccnc23)c1 |
| InChI | InChI=1S/C15H11ClN2O3/c16-12-3-4-13(14-11(12)2-1-5-17-14)18-7-10-6-9(8-21-10)15(19)20/h1-6,8,18H,7H2,(H,19,20) |
| InChIKey | BRWPXPUXQOUICO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |