C12H9Cl2NO3 — CID 113432526
5-[(2,6-dichloroanilino)methyl]furan-3-carboxylic acid (PubChem CID 113432526) has the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. Its IUPAC name is 5-[(2,6-dichloroanilino)methyl]furan-3-carboxylic acid.
| Compound Name | 5-[(2,6-dichloroanilino)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 113432526 |
| Molecular Formula | C12H9Cl2NO3 |
| Molecular Weight | 286.11 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 5-[(2,6-dichloroanilino)methyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1coc(CNc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C12H9Cl2NO3/c13-9-2-1-3-10(14)11(9)15-5-8-4-7(6-18-8)12(16)17/h1-4,6,15H,5H2,(H,16,17) |
| InChIKey | VEXQBOKJNUZTNJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.11 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |