C14H14N2O5 — CID 104608682
5-[[3-(methoxycarbonylamino)anilino]methyl]furan-3-carboxylic acid (PubChem CID 104608682) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is 5-[[3-(methoxycarbonylamino)anilino]methyl]furan-3-carboxylic acid.
| Compound Name | 5-[[3-(methoxycarbonylamino)anilino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104608682 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-[[3-(methoxycarbonylamino)anilino]methyl]furan-3-carboxylic acid |
| SMILES | COC(=O)Nc1cccc(NCc2cc(C(=O)O)co2)c1 |
| InChI | InChI=1S/C14H14N2O5/c1-20-14(19)16-11-4-2-3-10(6-11)15-7-12-5-9(8-21-12)13(17)18/h2-6,8,15H,7H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | RKXUHQLKJQYDFJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |