C15H13NO3 — CID 104607899
methyl 5-[(3-ethynylanilino)methyl]furan-3-carboxylate (PubChem CID 104607899) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is methyl 5-[(3-ethynylanilino)methyl]furan-3-carboxylate.
| Compound Name | methyl 5-[(3-ethynylanilino)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 104607899 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | methyl 5-[(3-ethynylanilino)methyl]furan-3-carboxylate |
| SMILES | C#Cc1cccc(NCc2cc(C(=O)OC)co2)c1 |
| InChI | InChI=1S/C15H13NO3/c1-3-11-5-4-6-13(7-11)16-9-14-8-12(10-19-14)15(17)18-2/h1,4-8,10,16H,9H2,2H3 |
| InChIKey | MUNPHBBXEKTTGJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|