C15H11N3O3 — CID 107788621
methyl 5-[(3,4-dicyanoanilino)methyl]furan-3-carboxylate (PubChem CID 107788621) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is methyl 5-[(3,4-dicyanoanilino)methyl]furan-3-carboxylate.
| Compound Name | methyl 5-[(3,4-dicyanoanilino)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 107788621 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | methyl 5-[(3,4-dicyanoanilino)methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1coc(CNc2ccc(C#N)c(C#N)c2)c1 |
| InChI | InChI=1S/C15H11N3O3/c1-20-15(19)12-5-14(21-9-12)8-18-13-3-2-10(6-16)11(4-13)7-17/h2-5,9,18H,8H2,1H3 |
| InChIKey | ZAAMNSAMJZMZLC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 99.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |