C12H9BrN2O5 — CID 43686260
N-[(5-bromofuran-2-yl)methyl]-6-nitro-1,3-benzodioxol-5-amine (PubChem CID 43686260) has the molecular formula C12H9BrN2O5 and a molecular weight of 341.12 g/mol. Its IUPAC name is N-[(5-bromofuran-2-yl)methyl]-6-nitro-1,3-benzodioxol-5-amine.
| Compound Name | N-[(5-bromofuran-2-yl)methyl]-6-nitro-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 43686260 |
| Molecular Formula | C12H9BrN2O5 |
| Molecular Weight | 341.12 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | N-[(5-bromofuran-2-yl)methyl]-6-nitro-1,3-benzodioxol-5-amine |
| SMILES | O=[N+]([O-])c1cc2c(cc1NCc1ccc(Br)o1)OCO2 |
| InChI | InChI=1S/C12H9BrN2O5/c13-12-2-1-7(20-12)5-14-8-3-10-11(19-6-18-10)4-9(8)15(16)17/h1-4,14H,5-6H2 |
| InChIKey | WLBLVMBTAOMHQV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 86.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.12 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|