C9H7Cl2NO5 — CID 68613175
5-(dichloromethoxymethyl)-6-nitro-1,3-benzodioxole (PubChem CID 68613175) has the molecular formula C9H7Cl2NO5 and a molecular weight of 280.06 g/mol. Its IUPAC name is 5-(dichloromethoxymethyl)-6-nitro-1,3-benzodioxole.
| Compound Name | 5-(dichloromethoxymethyl)-6-nitro-1,3-benzodioxole |
|---|---|
| PubChem CID | 68613175 |
| Molecular Formula | C9H7Cl2NO5 |
| Molecular Weight | 280.06 g/mol |
| Exact Mass | 278.97 |
| IUPAC Name | 5-(dichloromethoxymethyl)-6-nitro-1,3-benzodioxole |
| SMILES | O=[N+]([O-])c1cc2c(cc1COC(Cl)Cl)OCO2 |
| InChI | InChI=1S/C9H7Cl2NO5/c10-9(11)15-3-5-1-7-8(17-4-16-7)2-6(5)12(13)14/h1-2,9H,3-4H2 |
| InChIKey | PAOGNZMWXBJRFG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.06 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|