4-bromo-5-fluoro-2-nitrobenzoyl chloride

C7H2BrClFNO3 — CID 124925511

IUPAC4-bromo-5-fluoro-2-nitrobenzoyl chloride
SMILESO=C(Cl)c1cc(F)c(Br)cc1[N+](=O)[O-]
InChIInChI=1S/C7H2BrClFNO3/c8-4-2-6(11(13)14)3(7(9)12)1-5(4)10/h1-2H
InChIKeyAZGFZMBRQDSXMY-UHFFFAOYSA-N
MW282.45 g/mol
LogP2.88
Rot. Bonds2

About 4-bromo-5-fluoro-2-nitrobenzoyl chloride

4-bromo-5-fluoro-2-nitrobenzoyl chloride (PubChem CID 124925511) has the molecular formula C7H2BrClFNO3 and a molecular weight of 282.45 g/mol. Its IUPAC name is 4-bromo-5-fluoro-2-nitrobenzoyl chloride.

Molecular Properties

Compound Name4-bromo-5-fluoro-2-nitrobenzoyl chloride
PubChem CID124925511
Molecular FormulaC7H2BrClFNO3
Molecular Weight282.45 g/mol
Exact Mass280.89
IUPAC Name4-bromo-5-fluoro-2-nitrobenzoyl chloride
SMILESO=C(Cl)c1cc(F)c(Br)cc1[N+](=O)[O-]
InChIInChI=1S/C7H2BrClFNO3/c8-4-2-6(11(13)14)3(7(9)12)1-5(4)10/h1-2H
InChIKeyAZGFZMBRQDSXMY-UHFFFAOYSA-N
XLogP2.88
TPSA60.21 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.45
LogP ≤ 52.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-bromo-5-fluoro-2-nitrobenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-bromo-5-fluoro-2-nitrobenzoyl chloride?
The IUPAC name of 4-bromo-5-fluoro-2-nitrobenzoyl chloride (CID 124925511) is 4-bromo-5-fluoro-2-nitrobenzoyl chloride.
What is the SMILES notation for 4-bromo-5-fluoro-2-nitrobenzoyl chloride?
The canonical SMILES for 4-bromo-5-fluoro-2-nitrobenzoyl chloride is O=C(Cl)c1cc(F)c(Br)cc1[N+](=O)[O-].
What is the InChIKey of 4-bromo-5-fluoro-2-nitrobenzoyl chloride?
The InChIKey is AZGFZMBRQDSXMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2BrClFNO3/c8-4-2-6(11(13)14)3(7(9)12)1-5(4)10/h1-2H.
What are the key properties of 4-bromo-5-fluoro-2-nitrobenzoyl chloride?
4-bromo-5-fluoro-2-nitrobenzoyl chloride has a molecular weight of 282.45 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-fluoro-2-nitrobenzoyl chloride is sourced from PubChem (CID 124925511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).