C8H4N2O4 — CID 10058388
6-diazonio-1,3-benzodioxole-5-carboxylate (PubChem CID 10058388) has the molecular formula C8H4N2O4 and a molecular weight of 192.13 g/mol. Its IUPAC name is 6-diazonio-1,3-benzodioxole-5-carboxylate.
| Compound Name | 6-diazonio-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 10058388 |
| Molecular Formula | C8H4N2O4 |
| Molecular Weight | 192.13 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 6-diazonio-1,3-benzodioxole-5-carboxylate |
| SMILES | N#[N+]c1cc2c(cc1C(=O)[O-])OCO2 |
| InChI | InChI=1S/C8H4N2O4/c9-10-5-2-7-6(13-3-14-7)1-4(5)8(11)12/h1-2H,3H2 |
| InChIKey | GMHBNAXOZUIIOY-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.13 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|