C16H15N3O8S — CID 26782025
N-(4-methoxy-3-sulfamoylphenyl)-6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxamide (PubChem CID 26782025) has the molecular formula C16H15N3O8S and a molecular weight of 409.38 g/mol. Its IUPAC name is N-(4-methoxy-3-sulfamoylphenyl)-6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxamide.
| Compound Name | N-(4-methoxy-3-sulfamoylphenyl)-6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxamide |
|---|---|
| PubChem CID | 26782025 |
| Molecular Formula | C16H15N3O8S |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | N-(4-methoxy-3-sulfamoylphenyl)-6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3c(cc2[N+](=O)[O-])OCCO3)cc1S(N)(=O)=O |
| InChI | InChI=1S/C16H15N3O8S/c1-25-12-3-2-9(6-15(12)28(17,23)24)18-16(20)10-7-13-14(27-5-4-26-13)8-11(10)19(21)22/h2-3,6-8H,4-5H2,1H3,(H,18,20)(H2,17,23,24) |
| InChIKey | BUEOINAFSDZFOO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 160.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|