C15H18N2O7 — CID 120614196
(2S)-2-[(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]hexanoic acid (PubChem CID 120614196) has the molecular formula C15H18N2O7 and a molecular weight of 338.32 g/mol. Its IUPAC name is (2S)-2-[(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]hexanoic acid.
| Compound Name | (2S)-2-[(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 120614196 |
| Molecular Formula | C15H18N2O7 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (2S)-2-[(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2)C(=O)O |
| InChI | InChI=1S/C15H18N2O7/c1-2-3-4-10(15(19)20)16-14(18)9-7-12-13(24-6-5-23-12)8-11(9)17(21)22/h7-8,10H,2-6H2,1H3,(H,16,18)(H,19,20)/t10-/m0/s1 |
| InChIKey | QQOQYWKTAWJROI-JTQLQIEISA-N |
| XLogP | 1.74 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|