C10H8N2O6 — CID 2834238
1-(5-nitro-6-nitroso-2,3-dihydro-1,4-benzodioxin-7-yl)ethanone (PubChem CID 2834238) has the molecular formula C10H8N2O6 and a molecular weight of 252.18 g/mol. Its IUPAC name is 1-(5-nitro-6-nitroso-2,3-dihydro-1,4-benzodioxin-7-yl)ethanone.
| Compound Name | 1-(5-nitro-6-nitroso-2,3-dihydro-1,4-benzodioxin-7-yl)ethanone |
|---|---|
| PubChem CID | 2834238 |
| Molecular Formula | C10H8N2O6 |
| Molecular Weight | 252.18 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 1-(5-nitro-6-nitroso-2,3-dihydro-1,4-benzodioxin-7-yl)ethanone |
| SMILES | CC(=O)c1cc2c(c([N+](=O)[O-])c1N=O)OCCO2 |
| InChI | InChI=1S/C10H8N2O6/c1-5(13)6-4-7-10(18-3-2-17-7)9(12(15)16)8(6)11-14/h4H,2-3H2,1H3 |
| InChIKey | NGYIQEHMYKFTEM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.18 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|