C9H8N4O6S — CID 169357834
(5,6-dinitro-2,3-dihydro-1,4-benzodioxin-7-yl)thiourea (PubChem CID 169357834) has the molecular formula C9H8N4O6S and a molecular weight of 300.25 g/mol. Its IUPAC name is (5,6-dinitro-2,3-dihydro-1,4-benzodioxin-7-yl)thiourea.
| Compound Name | (5,6-dinitro-2,3-dihydro-1,4-benzodioxin-7-yl)thiourea |
|---|---|
| PubChem CID | 169357834 |
| Molecular Formula | C9H8N4O6S |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | (5,6-dinitro-2,3-dihydro-1,4-benzodioxin-7-yl)thiourea |
| SMILES | NC(=S)Nc1cc2c(c([N+](=O)[O-])c1[N+](=O)[O-])OCCO2 |
| InChI | InChI=1S/C9H8N4O6S/c10-9(20)11-4-3-5-8(19-2-1-18-5)7(13(16)17)6(4)12(14)15/h3H,1-2H2,(H3,10,11,20) |
| InChIKey | ZAFFHOPTYINBTE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 142.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|