C9H9N3O4S — CID 43286628
N-diazo-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide (PubChem CID 43286628) has the molecular formula C9H9N3O4S and a molecular weight of 255.25 g/mol. Its IUPAC name is N-diazo-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide.
| Compound Name | N-diazo-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
|---|---|
| PubChem CID | 43286628 |
| Molecular Formula | C9H9N3O4S |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | N-diazo-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
| SMILES | [N-]=[N+]=NS(=O)(=O)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C9H9N3O4S/c10-11-12-17(13,14)7-2-3-8-9(6-7)16-5-1-4-15-8/h2-3,6H,1,4-5H2 |
| InChIKey | HOJPGFNRQYTTAZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|