C22H21N3O3Si — CID 70941246
N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-3-(4-trimethylsilylphenyl)benzamide (PubChem CID 70941246) has the molecular formula C22H21N3O3Si and a molecular weight of 403.51 g/mol. Its IUPAC name is N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-3-(4-trimethylsilylphenyl)benzamide.
| Compound Name | N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-3-(4-trimethylsilylphenyl)benzamide |
|---|---|
| PubChem CID | 70941246 |
| Molecular Formula | C22H21N3O3Si |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-3-(4-trimethylsilylphenyl)benzamide |
| SMILES | C[Si](C)(C)c1ccc(-c2cccc(C(=O)Nc3nnc(-c4ccco4)o3)c2)cc1 |
| InChI | InChI=1S/C22H21N3O3Si/c1-29(2,3)18-11-9-15(10-12-18)16-6-4-7-17(14-16)20(26)23-22-25-24-21(28-22)19-8-5-13-27-19/h4-14H,1-3H3,(H,23,25,26) |
| InChIKey | RAYVCKFDASDEHF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|