C15H7F2N5O6 — CID 43972170
N-[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]-3,5-dinitrobenzamide (PubChem CID 43972170) has the molecular formula C15H7F2N5O6 and a molecular weight of 391.25 g/mol. Its IUPAC name is N-[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 43972170 |
| Molecular Formula | C15H7F2N5O6 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | N-[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]-3,5-dinitrobenzamide |
| SMILES | O=C(Nc1nnc(-c2ccc(F)cc2F)o1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H7F2N5O6/c16-8-1-2-11(12(17)5-8)14-19-20-15(28-14)18-13(23)7-3-9(21(24)25)6-10(4-7)22(26)27/h1-6H,(H,18,20,23) |
| InChIKey | LFEMNBPDIXUMJE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|