C15H9F2N3O2 — CID 43972074
N-[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 43972074) has the molecular formula C15H9F2N3O2 and a molecular weight of 301.25 g/mol. Its IUPAC name is N-[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | N-[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 43972074 |
| Molecular Formula | C15H9F2N3O2 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(-c2ccc(F)cc2F)o1)c1ccccc1 |
| InChI | InChI=1S/C15H9F2N3O2/c16-10-6-7-11(12(17)8-10)14-19-20-15(22-14)18-13(21)9-4-2-1-3-5-9/h1-8H,(H,18,20,21) |
| InChIKey | KDRCBNIJPFTJBS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |