C18H15ClFN3O3S2 — CID 44759858
1-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenyl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 44759858) has the molecular formula C18H15ClFN3O3S2 and a molecular weight of 439.92 g/mol. Its IUPAC name is 1-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenyl]-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenyl]-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 44759858 |
| Molecular Formula | C18H15ClFN3O3S2 |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | 1-[4-[(5-chlorothiophen-2-yl)sulfonylamino]phenyl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(F)cc1)Nc1ccc(NS(=O)(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C18H15ClFN3O3S2/c19-16-9-10-17(27-16)28(25,26)23-15-7-5-14(6-8-15)22-18(24)21-11-12-1-3-13(20)4-2-12/h1-10,23H,11H2,(H2,21,22,24) |
| InChIKey | SOKJAXUYCVCMNF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |