C60H42O18 — CID 138981671
[2,3,4,5,6-pentakis[(4-formylbenzoyl)oxymethyl]phenyl]methyl 3-formylbenzoate (PubChem CID 138981671) has the molecular formula C60H42O18 and a molecular weight of 1050.98 g/mol. Its IUPAC name is [2,3,4,5,6-pentakis[(4-formylbenzoyl)oxymethyl]phenyl]methyl 3-formylbenzoate.
| Compound Name | [2,3,4,5,6-pentakis[(4-formylbenzoyl)oxymethyl]phenyl]methyl 3-formylbenzoate |
|---|---|
| PubChem CID | 138981671 |
| Molecular Formula | C60H42O18 |
| Molecular Weight | 1050.98 g/mol |
| Exact Mass | 1050.24 |
| IUPAC Name | [2,3,4,5,6-pentakis[(4-formylbenzoyl)oxymethyl]phenyl]methyl 3-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)OCc2c(COC(=O)c3ccc(C=O)cc3)c(COC(=O)c3ccc(C=O)cc3)c(COC(=O)c3cccc(C=O)c3)c(COC(=O)c3ccc(C=O)cc3)c2COC(=O)c2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C60H42O18/c61-25-37-4-14-43(15-5-37)55(67)73-31-49-50(32-74-56(68)44-16-6-38(26-62)7-17-44)52(34-76-58(70)46-20-10-40(28-64)11-21-46)54(36-78-60(72)48-3-1-2-42(24-48)30-66)53(35-77-59(71)47-22-12-41(29-65)13-23-47)51(49)33-75-57(69)45-18-8-39(27-63)9-19-45/h1-30H,31-36H2 |
| InChIKey | VPDIUZVUJUXNFQ-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 260.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1050.98 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|