C13H9ClO3S — CID 55313426
(5-chlorothiophen-2-yl)methyl 4-formylbenzoate (PubChem CID 55313426) has the molecular formula C13H9ClO3S and a molecular weight of 280.73 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)methyl 4-formylbenzoate.
| Compound Name | (5-chlorothiophen-2-yl)methyl 4-formylbenzoate |
|---|---|
| PubChem CID | 55313426 |
| Molecular Formula | C13H9ClO3S |
| Molecular Weight | 280.73 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | (5-chlorothiophen-2-yl)methyl 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)OCc2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C13H9ClO3S/c14-12-6-5-11(18-12)8-17-13(16)10-3-1-9(7-15)2-4-10/h1-7H,8H2 |
| InChIKey | FDPIRGBGEHCHRC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.73 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|