About 3-formylbenzoic acid;3-methoxy-1H-pyridazin-4-one
3-formylbenzoic acid;3-methoxy-1H-pyridazin-4-one (PubChem CID 159358599) has the molecular formula C13H12N2O5
and a molecular weight of 276.25 g/mol. Its IUPAC name is 3-formylbenzoic acid;3-methoxy-1H-pyridazin-4-one.
Molecular Properties
| Compound Name | 3-formylbenzoic acid;3-methoxy-1H-pyridazin-4-one |
| PubChem CID | 159358599 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-formylbenzoic acid;3-methoxy-1H-pyridazin-4-one |
| SMILES | COc1n[nH]ccc1=O.O=Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C8H6O3.C5H6N2O2/c9-5-6-2-1-3-7(4-6)8(10)11;1-9-5-4(8)2-3-6-7-5/h1-5H,(H,10,11);2-3H,1H3,(H,6,8) |
| InChIKey | LIFXPLFCDHLBTJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-formylbenzoic acid;3-methoxy-1H-pyridazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-formylbenzoic acid;3-methoxy-1H-pyridazin-4-one?
The IUPAC name of 3-formylbenzoic acid;3-methoxy-1H-pyridazin-4-one (CID 159358599) is 3-formylbenzoic acid;3-methoxy-1H-pyridazin-4-one.
What is the SMILES notation for 3-formylbenzoic acid;3-methoxy-1H-pyridazin-4-one?
The canonical SMILES for 3-formylbenzoic acid;3-methoxy-1H-pyridazin-4-one is COc1n[nH]ccc1=O.O=Cc1cccc(C(=O)O)c1.
What is the InChIKey of 3-formylbenzoic acid;3-methoxy-1H-pyridazin-4-one?
The InChIKey is LIFXPLFCDHLBTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O3.C5H6N2O2/c9-5-6-2-1-3-7(4-6)8(10)11;1-9-5-4(8)2-3-6-7-5/h1-5H,(H,10,11);2-3H,1H3,(H,6,8).
What are the key properties of 3-formylbenzoic acid;3-methoxy-1H-pyridazin-4-one?
3-formylbenzoic acid;3-methoxy-1H-pyridazin-4-one has a molecular weight of 276.25 g/mol, XLogP of 0.98, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-formylbenzoic acid;3-methoxy-1H-pyridazin-4-one is sourced from PubChem (CID 159358599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).