C10H12N2O2 — CID 154463636
aminomethyl 1,3-dihydroisoindole-2-carboxylate (PubChem CID 154463636) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is aminomethyl 1,3-dihydroisoindole-2-carboxylate.
| Compound Name | aminomethyl 1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 154463636 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | aminomethyl 1,3-dihydroisoindole-2-carboxylate |
| SMILES | NCOC(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C10H12N2O2/c11-7-14-10(13)12-5-8-3-1-2-4-9(8)6-12/h1-4H,5-7,11H2 |
| InChIKey | OCTGVYKMBPEJKS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|