C13H17FN3OS+ — CID 7573816
4-fluoro-N-(4-methylpiperazin-4-ium-1-carbothioyl)benzamide (PubChem CID 7573816) has the molecular formula C13H17FN3OS+ and a molecular weight of 282.36 g/mol. Its IUPAC name is 4-fluoro-N-(4-methylpiperazin-4-ium-1-carbothioyl)benzamide.
| Compound Name | 4-fluoro-N-(4-methylpiperazin-4-ium-1-carbothioyl)benzamide |
|---|---|
| PubChem CID | 7573816 |
| Molecular Formula | C13H17FN3OS+ |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4-fluoro-N-(4-methylpiperazin-4-ium-1-carbothioyl)benzamide |
| SMILES | C[NH+]1CCN(C(=S)NC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C13H16FN3OS/c1-16-6-8-17(9-7-16)13(19)15-12(18)10-2-4-11(14)5-3-10/h2-5H,6-9H2,1H3,(H,15,18,19)/p+1 |
| InChIKey | CAKZVILUOZVIEK-UHFFFAOYSA-O |
| XLogP | -0.33 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|