C11H17IN5OS+ — CID 7241455
4-iodo-1-methyl-N-(4-methylpiperazin-4-ium-1-carbothioyl)pyrazole-3-carboxamide (PubChem CID 7241455) has the molecular formula C11H17IN5OS+ and a molecular weight of 394.26 g/mol. Its IUPAC name is 4-iodo-1-methyl-N-(4-methylpiperazin-4-ium-1-carbothioyl)pyrazole-3-carboxamide.
| Compound Name | 4-iodo-1-methyl-N-(4-methylpiperazin-4-ium-1-carbothioyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 7241455 |
| Molecular Formula | C11H17IN5OS+ |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 4-iodo-1-methyl-N-(4-methylpiperazin-4-ium-1-carbothioyl)pyrazole-3-carboxamide |
| SMILES | Cn1cc(I)c(C(=O)NC(=S)N2CC[NH+](C)CC2)n1 |
| InChI | InChI=1S/C11H16IN5OS/c1-15-3-5-17(6-4-15)11(19)13-10(18)9-8(12)7-16(2)14-9/h7H,3-6H2,1-2H3,(H,13,18,19)/p+1 |
| InChIKey | ONRLWNZFDBWTPE-UHFFFAOYSA-O |
| XLogP | -1.13 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|