C21H14Cl2F4N2O2 — CID 17335544
[5-(4-chlorophenyl)furan-2-yl]-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazin-1-yl]methanone (PubChem CID 17335544) has the molecular formula C21H14Cl2F4N2O2 and a molecular weight of 473.25 g/mol. Its IUPAC name is [5-(4-chlorophenyl)furan-2-yl]-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazin-1-yl]methanone.
| Compound Name | [5-(4-chlorophenyl)furan-2-yl]-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 17335544 |
| Molecular Formula | C21H14Cl2F4N2O2 |
| Molecular Weight | 473.25 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | [5-(4-chlorophenyl)furan-2-yl]-[4-(4-chloro-2,3,5,6-tetrafluorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(-c2ccc(Cl)cc2)o1)N1CCN(c2c(F)c(F)c(Cl)c(F)c2F)CC1 |
| InChI | InChI=1S/C21H14Cl2F4N2O2/c22-12-3-1-11(2-4-12)13-5-6-14(31-13)21(30)29-9-7-28(8-10-29)20-18(26)16(24)15(23)17(25)19(20)27/h1-6H,7-10H2 |
| InChIKey | VHLXBMPTXDQHRJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.25 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|