C24H19Cl3N4O4S — CID 3287420
N-[4-(2-chloro-4-nitrophenyl)piperazine-1-carbothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 3287420) has the molecular formula C24H19Cl3N4O4S and a molecular weight of 565.87 g/mol. Its IUPAC name is N-[4-(2-chloro-4-nitrophenyl)piperazine-1-carbothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[4-(2-chloro-4-nitrophenyl)piperazine-1-carbothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3287420 |
| Molecular Formula | C24H19Cl3N4O4S |
| Molecular Weight | 565.87 g/mol |
| Exact Mass | 564.02 |
| IUPAC Name | N-[4-(2-chloro-4-nitrophenyl)piperazine-1-carbothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2ccc(Cl)cc2Cl)o1)NC(=S)N1CCN(c2ccc([N+](=O)[O-])cc2Cl)CC1 |
| InChI | InChI=1S/C24H19Cl3N4O4S/c25-15-1-5-18(19(26)13-15)22-7-3-17(35-22)4-8-23(32)28-24(36)30-11-9-29(10-12-30)21-6-2-16(31(33)34)14-20(21)27/h1-8,13-14H,9-12H2,(H,28,32,36) |
| InChIKey | OSMQZTRJRIAOOD-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.87 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|