C29H30Cl2N4O3S — CID 17334697
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]prop-2-enamide (PubChem CID 17334697) has the molecular formula C29H30Cl2N4O3S and a molecular weight of 585.56 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17334697 |
| Molecular Formula | C29H30Cl2N4O3S |
| Molecular Weight | 585.56 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]prop-2-enamide |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc(NC(=S)NC(=O)/C=C/c3ccc(-c4cc(Cl)cc(Cl)c4)o3)cc2)CC1 |
| InChI | InChI=1S/C29H30Cl2N4O3S/c1-19(2)15-28(37)35-13-11-34(12-14-35)24-5-3-23(4-6-24)32-29(39)33-27(36)10-8-25-7-9-26(38-25)20-16-21(30)18-22(31)17-20/h3-10,16-19H,11-15H2,1-2H3,(H2,32,33,36,39)/b10-8+ |
| InChIKey | INLMYQJSXQPXCQ-CSKARUKUSA-N |
| XLogP | 6.47 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|