C21H17Cl3N2O2 — CID 17272468
N-(3-chloro-4-pyrrolidin-1-ylphenyl)-5-(2,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 17272468) has the molecular formula C21H17Cl3N2O2 and a molecular weight of 435.74 g/mol. Its IUPAC name is N-(3-chloro-4-pyrrolidin-1-ylphenyl)-5-(2,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-(3-chloro-4-pyrrolidin-1-ylphenyl)-5-(2,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17272468 |
| Molecular Formula | C21H17Cl3N2O2 |
| Molecular Weight | 435.74 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | N-(3-chloro-4-pyrrolidin-1-ylphenyl)-5-(2,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(Cl)c1)c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C21H17Cl3N2O2/c22-13-3-5-15(16(23)11-13)19-7-8-20(28-19)21(27)25-14-4-6-18(17(24)12-14)26-9-1-2-10-26/h3-8,11-12H,1-2,9-10H2,(H,25,27) |
| InChIKey | MJMMCWVDBUVDCV-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.74 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|