C29H24Cl3N3O3 — CID 3958836
N-[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide (PubChem CID 3958836) has the molecular formula C29H24Cl3N3O3 and a molecular weight of 568.89 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3958836 |
| Molecular Formula | C29H24Cl3N3O3 |
| Molecular Weight | 568.89 g/mol |
| Exact Mass | 567.09 |
| IUPAC Name | N-[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-5-(2,5-dichlorophenyl)furan-2-carboxamide |
| SMILES | Cc1ccccc1C(=O)N1CCN(c2ccc(NC(=O)c3ccc(-c4cc(Cl)ccc4Cl)o3)cc2Cl)CC1 |
| InChI | InChI=1S/C29H24Cl3N3O3/c1-18-4-2-3-5-21(18)29(37)35-14-12-34(13-15-35)25-9-7-20(17-24(25)32)33-28(36)27-11-10-26(38-27)22-16-19(30)6-8-23(22)31/h2-11,16-17H,12-15H2,1H3,(H,33,36) |
| InChIKey | WPUFJNKILCQNNT-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.89 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|