C30H25ClF3N3O3 — CID 43913509
N-[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 43913509) has the molecular formula C30H25ClF3N3O3 and a molecular weight of 568.00 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 43913509 |
| Molecular Formula | C30H25ClF3N3O3 |
| Molecular Weight | 568.00 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | N-[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | Cc1ccccc1C(=O)N1CCN(c2ccc(NC(=O)c3ccc(-c4cccc(C(F)(F)F)c4)o3)cc2Cl)CC1 |
| InChI | InChI=1S/C30H25ClF3N3O3/c1-19-5-2-3-8-23(19)29(39)37-15-13-36(14-16-37)25-10-9-22(18-24(25)31)35-28(38)27-12-11-26(40-27)20-6-4-7-21(17-20)30(32,33)34/h2-12,17-18H,13-16H2,1H3,(H,35,38) |
| InChIKey | MWJGIWDREXKXNR-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.00 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|