C32H30ClN3O2 — CID 3462669
N-[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-2,2-diphenylacetamide (PubChem CID 3462669) has the molecular formula C32H30ClN3O2 and a molecular weight of 524.06 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-2,2-diphenylacetamide.
| Compound Name | N-[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 3462669 |
| Molecular Formula | C32H30ClN3O2 |
| Molecular Weight | 524.06 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | N-[3-chloro-4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-2,2-diphenylacetamide |
| SMILES | Cc1ccccc1C(=O)N1CCN(c2ccc(NC(=O)C(c3ccccc3)c3ccccc3)cc2Cl)CC1 |
| InChI | InChI=1S/C32H30ClN3O2/c1-23-10-8-9-15-27(23)32(38)36-20-18-35(19-21-36)29-17-16-26(22-28(29)33)34-31(37)30(24-11-4-2-5-12-24)25-13-6-3-7-14-25/h2-17,22,30H,18-21H2,1H3,(H,34,37) |
| InChIKey | XBHKHDTVJCXCRO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.06 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|