C19H13ClN2O3 — CID 86872698
5-(2-chlorophenyl)-N-(3-oxo-1,2-dihydroisoindol-5-yl)furan-2-carboxamide (PubChem CID 86872698) has the molecular formula C19H13ClN2O3 and a molecular weight of 352.78 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-(3-oxo-1,2-dihydroisoindol-5-yl)furan-2-carboxamide.
| Compound Name | 5-(2-chlorophenyl)-N-(3-oxo-1,2-dihydroisoindol-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 86872698 |
| Molecular Formula | C19H13ClN2O3 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 5-(2-chlorophenyl)-N-(3-oxo-1,2-dihydroisoindol-5-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)NC2)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C19H13ClN2O3/c20-15-4-2-1-3-13(15)16-7-8-17(25-16)19(24)22-12-6-5-11-10-21-18(23)14(11)9-12/h1-9H,10H2,(H,21,23)(H,22,24) |
| InChIKey | WZJZGGZEXLCLGT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |