C18H12ClNO4 — CID 8869966
N-(1,3-benzodioxol-5-yl)-5-(2-chlorophenyl)furan-2-carboxamide (PubChem CID 8869966) has the molecular formula C18H12ClNO4 and a molecular weight of 341.75 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-(2-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-(2-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 8869966 |
| Molecular Formula | C18H12ClNO4 |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-(2-chlorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C18H12ClNO4/c19-13-4-2-1-3-12(13)14-7-8-16(24-14)18(21)20-11-5-6-15-17(9-11)23-10-22-15/h1-9H,10H2,(H,20,21) |
| InChIKey | DEFHNHYHFVKKKK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |