C18H12FNO4 — CID 27648507
N-(1,3-benzodioxol-5-yl)-5-(4-fluorophenyl)furan-2-carboxamide (PubChem CID 27648507) has the molecular formula C18H12FNO4 and a molecular weight of 325.30 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-(4-fluorophenyl)furan-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-(4-fluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 27648507 |
| Molecular Formula | C18H12FNO4 |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-(4-fluorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C18H12FNO4/c19-12-3-1-11(2-4-12)14-7-8-16(24-14)18(21)20-13-5-6-15-17(9-13)23-10-22-15/h1-9H,10H2,(H,20,21) |
| InChIKey | VVTVJUFKWYLTRQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |