C16H16ClFN2O3 — CID 138049378
1-(3-chloro-1-methylindole-2-carbonyl)-3-(fluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 138049378) has the molecular formula C16H16ClFN2O3 and a molecular weight of 338.77 g/mol. Its IUPAC name is 1-(3-chloro-1-methylindole-2-carbonyl)-3-(fluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(3-chloro-1-methylindole-2-carbonyl)-3-(fluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 138049378 |
| Molecular Formula | C16H16ClFN2O3 |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 1-(3-chloro-1-methylindole-2-carbonyl)-3-(fluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | Cn1c(C(=O)N2CCC(CF)(C(=O)O)C2)c(Cl)c2ccccc21 |
| InChI | InChI=1S/C16H16ClFN2O3/c1-19-11-5-3-2-4-10(11)12(17)13(19)14(21)20-7-6-16(8-18,9-20)15(22)23/h2-5H,6-9H2,1H3,(H,22,23) |
| InChIKey | BZCNYYRQTFZKNW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |