C26H29ClF3NO4 — CID 168947574
(3S)-5-[5-[6-(3-chlorophenyl)hexyl]-4-methyl-2-(trifluoromethyl)furo[3,2-b]pyrrol-6-yl]-3-methyl-5-oxopentanoic acid (PubChem CID 168947574) has the molecular formula C26H29ClF3NO4 and a molecular weight of 511.97 g/mol. Its IUPAC name is (3S)-5-[5-[6-(3-chlorophenyl)hexyl]-4-methyl-2-(trifluoromethyl)furo[3,2-b]pyrrol-6-yl]-3-methyl-5-oxopentanoic acid.
| Compound Name | (3S)-5-[5-[6-(3-chlorophenyl)hexyl]-4-methyl-2-(trifluoromethyl)furo[3,2-b]pyrrol-6-yl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 168947574 |
| Molecular Formula | C26H29ClF3NO4 |
| Molecular Weight | 511.97 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | (3S)-5-[5-[6-(3-chlorophenyl)hexyl]-4-methyl-2-(trifluoromethyl)furo[3,2-b]pyrrol-6-yl]-3-methyl-5-oxopentanoic acid |
| SMILES | C[C@H](CC(=O)O)CC(=O)c1c(CCCCCCc2cccc(Cl)c2)n(C)c2cc(C(F)(F)F)oc12 |
| InChI | InChI=1S/C26H29ClF3NO4/c1-16(13-23(33)34)12-21(32)24-19(31(2)20-15-22(26(28,29)30)35-25(20)24)11-6-4-3-5-8-17-9-7-10-18(27)14-17/h7,9-10,14-16H,3-6,8,11-13H2,1-2H3,(H,33,34)/t16-/m0/s1 |
| InChIKey | RUQWRUVIZXSDHH-INIZCTEOSA-N |
| XLogP | 7.47 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.97 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|