C26H28Cl2F2O3 — CID 168947432
(3S)-6,13-bis(3-chlorophenyl)-8,8-difluoro-3-methyl-5-oxotridec-6-enoic acid (PubChem CID 168947432) has the molecular formula C26H28Cl2F2O3 and a molecular weight of 497.41 g/mol. Its IUPAC name is (3S)-6,13-bis(3-chlorophenyl)-8,8-difluoro-3-methyl-5-oxotridec-6-enoic acid.
| Compound Name | (3S)-6,13-bis(3-chlorophenyl)-8,8-difluoro-3-methyl-5-oxotridec-6-enoic acid |
|---|---|
| PubChem CID | 168947432 |
| Molecular Formula | C26H28Cl2F2O3 |
| Molecular Weight | 497.41 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | (3S)-6,13-bis(3-chlorophenyl)-8,8-difluoro-3-methyl-5-oxotridec-6-enoic acid |
| SMILES | C[C@H](CC(=O)O)CC(=O)C(=CC(F)(F)CCCCCc1cccc(Cl)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C26H28Cl2F2O3/c1-18(14-25(32)33)13-24(31)23(20-9-6-11-22(28)16-20)17-26(29,30)12-4-2-3-7-19-8-5-10-21(27)15-19/h5-6,8-11,15-18H,2-4,7,12-14H2,1H3,(H,32,33)/t18-/m0/s1 |
| InChIKey | IWKDUORXFBLNCR-SFHVURJKSA-N |
| XLogP | 7.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.41 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|