C22H27ClN2O3 — CID 168947581
(3S)-5-[3-[6-(3-chlorophenyl)hexyl]pyrazin-2-yl]-3-methyl-5-oxopentanoic acid (PubChem CID 168947581) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is (3S)-5-[3-[6-(3-chlorophenyl)hexyl]pyrazin-2-yl]-3-methyl-5-oxopentanoic acid.
| Compound Name | (3S)-5-[3-[6-(3-chlorophenyl)hexyl]pyrazin-2-yl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 168947581 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (3S)-5-[3-[6-(3-chlorophenyl)hexyl]pyrazin-2-yl]-3-methyl-5-oxopentanoic acid |
| SMILES | C[C@H](CC(=O)O)CC(=O)c1nccnc1CCCCCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H27ClN2O3/c1-16(14-21(27)28)13-20(26)22-19(24-11-12-25-22)10-5-3-2-4-7-17-8-6-9-18(23)15-17/h6,8-9,11-12,15-16H,2-5,7,10,13-14H2,1H3,(H,27,28)/t16-/m0/s1 |
| InChIKey | AZKXIVVQJCXXCL-INIZCTEOSA-N |
| XLogP | 5.16 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|