C21H29Cl2NO4 — CID 168947611
2-chloroacetaldehyde;ethyl 2-[4-[(3-chlorophenyl)methoxy]butyl]-1H-pyrrole-3-carboxylate;methane (PubChem CID 168947611) has the molecular formula C21H29Cl2NO4 and a molecular weight of 430.37 g/mol. Its IUPAC name is 2-chloroacetaldehyde;ethyl 2-[4-[(3-chlorophenyl)methoxy]butyl]-1H-pyrrole-3-carboxylate;methane.
| Compound Name | 2-chloroacetaldehyde;ethyl 2-[4-[(3-chlorophenyl)methoxy]butyl]-1H-pyrrole-3-carboxylate;methane |
|---|---|
| PubChem CID | 168947611 |
| Molecular Formula | C21H29Cl2NO4 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 2-chloroacetaldehyde;ethyl 2-[4-[(3-chlorophenyl)methoxy]butyl]-1H-pyrrole-3-carboxylate;methane |
| SMILES | C.CCOC(=O)c1cc[nH]c1CCCCOCc1cccc(Cl)c1.O=CCCl |
| InChI | InChI=1S/C18H22ClNO3.C2H3ClO.CH4/c1-2-23-18(21)16-9-10-20-17(16)8-3-4-11-22-13-14-6-5-7-15(19)12-14;3-1-2-4;/h5-7,9-10,12,20H,2-4,8,11,13H2,1H3;2H,1H2;1H4 |
| InChIKey | HBXDACYHCSLKFU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|