C16H22ClNO — CID 168947503
6-[(3-chlorophenyl)methoxy]-N-ethenyl-N-methylhex-1-en-2-amine (PubChem CID 168947503) has the molecular formula C16H22ClNO and a molecular weight of 279.81 g/mol. Its IUPAC name is 6-[(3-chlorophenyl)methoxy]-N-ethenyl-N-methylhex-1-en-2-amine.
| Compound Name | 6-[(3-chlorophenyl)methoxy]-N-ethenyl-N-methylhex-1-en-2-amine |
|---|---|
| PubChem CID | 168947503 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 6-[(3-chlorophenyl)methoxy]-N-ethenyl-N-methylhex-1-en-2-amine |
| SMILES | C=CN(C)C(=C)CCCCOCc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H22ClNO/c1-4-18(3)14(2)8-5-6-11-19-13-15-9-7-10-16(17)12-15/h4,7,9-10,12H,1-2,5-6,8,11,13H2,3H3 |
| InChIKey | CQMHMHOUMRNLNE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|