C23H27NO3 — CID 90995062
methyl 4-(cyclohexylmethoxyiminomethyl)-2-(2-methylphenyl)benzoate (PubChem CID 90995062) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is methyl 4-(cyclohexylmethoxyiminomethyl)-2-(2-methylphenyl)benzoate.
| Compound Name | methyl 4-(cyclohexylmethoxyiminomethyl)-2-(2-methylphenyl)benzoate |
|---|---|
| PubChem CID | 90995062 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | methyl 4-(cyclohexylmethoxyiminomethyl)-2-(2-methylphenyl)benzoate |
| SMILES | COC(=O)c1ccc(C=NOCC2CCCCC2)cc1-c1ccccc1C |
| InChI | InChI=1S/C23H27NO3/c1-17-8-6-7-11-20(17)22-14-19(12-13-21(22)23(25)26-2)15-24-27-16-18-9-4-3-5-10-18/h6-8,11-15,18H,3-5,9-10,16H2,1-2H3 |
| InChIKey | VGNBGTWOBGOLTJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|